About (4S)-3,3-dimethyl-4-[4-(trifluoromethyl)phenyl]pyrrolidine-1-carbaldehyde
(4S)-3,3-dimethyl-4-[4-(trifluoromethyl)phenyl]pyrrolidine-1-carbaldehyde (PubChem CID 175509150) has the molecular formula C14H16F3NO
and a molecular weight of 271.28 g/mol. Its IUPAC name is (4S)-3,3-dimethyl-4-[4-(trifluoromethyl)phenyl]pyrrolidine-1-carbaldehyde.
Molecular Properties
| Compound Name | (4S)-3,3-dimethyl-4-[4-(trifluoromethyl)phenyl]pyrrolidine-1-carbaldehyde |
| PubChem CID | 175509150 |
| Molecular Formula | C14H16F3NO |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | (4S)-3,3-dimethyl-4-[4-(trifluoromethyl)phenyl]pyrrolidine-1-carbaldehyde |
| SMILES | CC1(C)CN(C=O)C[C@H]1c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H16F3NO/c1-13(2)8-18(9-19)7-12(13)10-3-5-11(6-4-10)14(15,16)17/h3-6,9,12H,7-8H2,1-2H3/t12-/m0/s1 |
| InChIKey | WKKVBMCYOXVZJU-LBPRGKRZSA-N |
| XLogP | 3.29 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (4S)-3,3-dimethyl-4-[4-(trifluoromethyl)phenyl]pyrrolidine-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-3,3-dimethyl-4-[4-(trifluoromethyl)phenyl]pyrrolidine-1-carbaldehyde?
The IUPAC name of (4S)-3,3-dimethyl-4-[4-(trifluoromethyl)phenyl]pyrrolidine-1-carbaldehyde (CID 175509150) is (4S)-3,3-dimethyl-4-[4-(trifluoromethyl)phenyl]pyrrolidine-1-carbaldehyde.
What is the SMILES notation for (4S)-3,3-dimethyl-4-[4-(trifluoromethyl)phenyl]pyrrolidine-1-carbaldehyde?
The canonical SMILES for (4S)-3,3-dimethyl-4-[4-(trifluoromethyl)phenyl]pyrrolidine-1-carbaldehyde is CC1(C)CN(C=O)C[C@H]1c1ccc(C(F)(F)F)cc1.
What is the InChIKey of (4S)-3,3-dimethyl-4-[4-(trifluoromethyl)phenyl]pyrrolidine-1-carbaldehyde?
The InChIKey is WKKVBMCYOXVZJU-LBPRGKRZSA-N. The full InChI is InChI=1S/C14H16F3NO/c1-13(2)8-18(9-19)7-12(13)10-3-5-11(6-4-10)14(15,16)17/h3-6,9,12H,7-8H2,1-2H3/t12-/m0/s1.
What are the key properties of (4S)-3,3-dimethyl-4-[4-(trifluoromethyl)phenyl]pyrrolidine-1-carbaldehyde?
(4S)-3,3-dimethyl-4-[4-(trifluoromethyl)phenyl]pyrrolidine-1-carbaldehyde has a molecular weight of 271.28 g/mol, XLogP of 3.29, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-3,3-dimethyl-4-[4-(trifluoromethyl)phenyl]pyrrolidine-1-carbaldehyde is sourced from PubChem (CID 175509150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).