C13H14F3NO2 — CID 134964358
(5S)-2,5-dimethyl-3-[4-(trifluoromethyl)phenyl]-1,2-oxazolidine-5-carbaldehyde (PubChem CID 134964358) has the molecular formula C13H14F3NO2 and a molecular weight of 273.25 g/mol. Its IUPAC name is (5S)-2,5-dimethyl-3-[4-(trifluoromethyl)phenyl]-1,2-oxazolidine-5-carbaldehyde.
| Compound Name | (5S)-2,5-dimethyl-3-[4-(trifluoromethyl)phenyl]-1,2-oxazolidine-5-carbaldehyde |
|---|---|
| PubChem CID | 134964358 |
| Molecular Formula | C13H14F3NO2 |
| Molecular Weight | 273.25 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | (5S)-2,5-dimethyl-3-[4-(trifluoromethyl)phenyl]-1,2-oxazolidine-5-carbaldehyde |
| SMILES | CN1O[C@](C)(C=O)CC1c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H14F3NO2/c1-12(8-18)7-11(17(2)19-12)9-3-5-10(6-4-9)13(14,15)16/h3-6,8,11H,7H2,1-2H3/t11?,12-/m0/s1 |
| InChIKey | DFFZINGOEMWRCG-KIYNQFGBSA-N |
| XLogP | 2.97 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.25 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|