C20H21N3O6S — CID 175509556
(2,5-dioxopyrrolidin-1-yl) 4-(3-cyclopropyl-2,5-dioxo-3-pyridin-2-ylsulfanylpyrrolidin-1-yl)butanoate (PubChem CID 175509556) has the molecular formula C20H21N3O6S and a molecular weight of 431.47 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 4-(3-cyclopropyl-2,5-dioxo-3-pyridin-2-ylsulfanylpyrrolidin-1-yl)butanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 4-(3-cyclopropyl-2,5-dioxo-3-pyridin-2-ylsulfanylpyrrolidin-1-yl)butanoate |
|---|---|
| PubChem CID | 175509556 |
| Molecular Formula | C20H21N3O6S |
| Molecular Weight | 431.47 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-(3-cyclopropyl-2,5-dioxo-3-pyridin-2-ylsulfanylpyrrolidin-1-yl)butanoate |
| SMILES | O=C(CCCN1C(=O)CC(Sc2ccccn2)(C2CC2)C1=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C20H21N3O6S/c24-15-8-9-16(25)23(15)29-18(27)5-3-11-22-17(26)12-20(19(22)28,13-6-7-13)30-14-4-1-2-10-21-14/h1-2,4,10,13H,3,5-9,11-12H2 |
| InChIKey | NWKOWIJJKLSZRH-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 113.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.47 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|