C55H51N5O4 — CID 175510449
4-[2-[15-[2-(4-aminophenyl)ethynyl]-3-(2,6-dihexoxyphenyl)-21,24-dihydroporphyrin-5-yl]ethynyl]benzoic acid (PubChem CID 175510449) has the molecular formula C55H51N5O4 and a molecular weight of 846.04 g/mol. Its IUPAC name is 4-[2-[15-[2-(4-aminophenyl)ethynyl]-3-(2,6-dihexoxyphenyl)-21,24-dihydroporphyrin-5-yl]ethynyl]benzoic acid.
| Compound Name | 4-[2-[15-[2-(4-aminophenyl)ethynyl]-3-(2,6-dihexoxyphenyl)-21,24-dihydroporphyrin-5-yl]ethynyl]benzoic acid |
|---|---|
| PubChem CID | 175510449 |
| Molecular Formula | C55H51N5O4 |
| Molecular Weight | 846.04 g/mol |
| Exact Mass | 845.39 |
| IUPAC Name | 4-[2-[15-[2-(4-aminophenyl)ethynyl]-3-(2,6-dihexoxyphenyl)-21,24-dihydroporphyrin-5-yl]ethynyl]benzoic acid |
| SMILES | CCCCCCOc1cccc(OCCCCCC)c1-c1cc2cc3ccc([nH]3)c(C#Cc3ccc(N)cc3)c3nc(cc4nc(c(C#Cc5ccc(C(=O)O)cc5)c1[nH]2)C=C4)C=C3 |
| InChI | InChI=1S/C55H51N5O4/c1-3-5-7-9-32-63-51-12-11-13-52(64-33-10-8-6-4-2)53(51)47-36-44-35-43-25-30-49(58-43)45(27-18-38-16-22-40(56)23-17-38)48-29-24-41(57-48)34-42-26-31-50(59-42)46(54(47)60-44)28-19-37-14-20-39(21-15-37)55(61)62/h11-17,20-26,29-31,34-36,58,60H,3-10,32-33,56H2,1-2H3,(H,61,62)/b41-34-,42-34-,43-35-,44-35-,48-45-,49-45-,50-46-,54-46- |
| InChIKey | RSIMOUJTRDHFKN-XNXOBONYSA-N |
| XLogP | 12.32 |
| TPSA | 139.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 846.04 |
| LogP ≤ 5 | 12.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|