About 2-methoxyethyl phosphorosooxymethyl carbonate
2-methoxyethyl phosphorosooxymethyl carbonate (PubChem CID 175510993) has the molecular formula C5H9O6P
and a molecular weight of 196.09 g/mol. Its IUPAC name is 2-methoxyethyl phosphorosooxymethyl carbonate.
Molecular Properties
| Compound Name | 2-methoxyethyl phosphorosooxymethyl carbonate |
| PubChem CID | 175510993 |
| Molecular Formula | C5H9O6P |
| Molecular Weight | 196.09 g/mol |
| Exact Mass | 196.01 |
| IUPAC Name | 2-methoxyethyl phosphorosooxymethyl carbonate |
| SMILES | COCCOC(=O)OCOP=O |
| InChI | InChI=1S/C5H9O6P/c1-8-2-3-9-5(6)10-4-11-12-7/h2-4H2,1H3 |
| InChIKey | FGWVGKJFVIJOQQ-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.09 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxyethyl phosphorosooxymethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxyethyl phosphorosooxymethyl carbonate?
The IUPAC name of 2-methoxyethyl phosphorosooxymethyl carbonate (CID 175510993) is 2-methoxyethyl phosphorosooxymethyl carbonate.
What is the SMILES notation for 2-methoxyethyl phosphorosooxymethyl carbonate?
The canonical SMILES for 2-methoxyethyl phosphorosooxymethyl carbonate is COCCOC(=O)OCOP=O.
What is the InChIKey of 2-methoxyethyl phosphorosooxymethyl carbonate?
The InChIKey is FGWVGKJFVIJOQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9O6P/c1-8-2-3-9-5(6)10-4-11-12-7/h2-4H2,1H3.
What are the key properties of 2-methoxyethyl phosphorosooxymethyl carbonate?
2-methoxyethyl phosphorosooxymethyl carbonate has a molecular weight of 196.09 g/mol, XLogP of 0.97, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxyethyl phosphorosooxymethyl carbonate is sourced from PubChem (CID 175510993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).