About 3-methyl-1H-imidazol-3-ium;oxalic acid;chloride
3-methyl-1H-imidazol-3-ium;oxalic acid;chloride (PubChem CID 175511811) has the molecular formula C6H9ClN2O4
and a molecular weight of 208.60 g/mol. Its IUPAC name is 3-methyl-1H-imidazol-3-ium;oxalic acid;chloride.
Molecular Properties
| Compound Name | 3-methyl-1H-imidazol-3-ium;oxalic acid;chloride |
| PubChem CID | 175511811 |
| Molecular Formula | C6H9ClN2O4 |
| Molecular Weight | 208.60 g/mol |
| Exact Mass | 208.03 |
| IUPAC Name | 3-methyl-1H-imidazol-3-ium;oxalic acid;chloride |
| SMILES | C[n+]1cc[nH]c1.O=C(O)C(=O)O.[Cl-] |
| InChI | InChI=1S/C4H6N2.C2H2O4.ClH/c1-6-3-2-5-4-6;3-1(4)2(5)6;/h2-4H,1H3;(H,3,4)(H,5,6);1H |
| InChIKey | LHEIGICAURMPPB-UHFFFAOYSA-N |
| XLogP | -4.00 |
| TPSA | 94.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.60 |
| LogP ≤ 5 | -4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-1H-imidazol-3-ium;oxalic acid;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-1H-imidazol-3-ium;oxalic acid;chloride?
The IUPAC name of 3-methyl-1H-imidazol-3-ium;oxalic acid;chloride (CID 175511811) is 3-methyl-1H-imidazol-3-ium;oxalic acid;chloride.
What is the SMILES notation for 3-methyl-1H-imidazol-3-ium;oxalic acid;chloride?
The canonical SMILES for 3-methyl-1H-imidazol-3-ium;oxalic acid;chloride is C[n+]1cc[nH]c1.O=C(O)C(=O)O.[Cl-].
What is the InChIKey of 3-methyl-1H-imidazol-3-ium;oxalic acid;chloride?
The InChIKey is LHEIGICAURMPPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N2.C2H2O4.ClH/c1-6-3-2-5-4-6;3-1(4)2(5)6;/h2-4H,1H3;(H,3,4)(H,5,6);1H.
What are the key properties of 3-methyl-1H-imidazol-3-ium;oxalic acid;chloride?
3-methyl-1H-imidazol-3-ium;oxalic acid;chloride has a molecular weight of 208.60 g/mol, XLogP of -4.00, 0 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1H-imidazol-3-ium;oxalic acid;chloride is sourced from PubChem (CID 175511811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).