C4H9N2O4P — CID 45376396
dihydrogen phosphate;3-methyl-1H-imidazol-3-ium (PubChem CID 45376396) has the molecular formula C4H9N2O4P and a molecular weight of 180.10 g/mol. Its IUPAC name is dihydrogen phosphate;3-methyl-1H-imidazol-3-ium.
| Compound Name | dihydrogen phosphate;3-methyl-1H-imidazol-3-ium |
|---|---|
| PubChem CID | 45376396 |
| Molecular Formula | C4H9N2O4P |
| Molecular Weight | 180.10 g/mol |
| Exact Mass | 180.03 |
| IUPAC Name | dihydrogen phosphate;3-methyl-1H-imidazol-3-ium |
| SMILES | C[n+]1cc[nH]c1.O=P([O-])(O)O |
| InChI | InChI=1S/C4H6N2.H3O4P/c1-6-3-2-5-4-6;1-5(2,3)4/h2-4H,1H3;(H3,1,2,3,4) |
| InChIKey | GQLRFPJNVQIFPK-UHFFFAOYSA-N |
| XLogP | -1.72 |
| TPSA | 100.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.10 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|