C20H24ClN5O2 — CID 175521030
[6-(2-amino-4-chloroimidazo[4,5-c]pyridin-3-yl)-1-phenylheptyl] carbamate (PubChem CID 175521030) has the molecular formula C20H24ClN5O2 and a molecular weight of 401.90 g/mol. Its IUPAC name is [6-(2-amino-4-chloroimidazo[4,5-c]pyridin-3-yl)-1-phenylheptyl] carbamate.
| Compound Name | [6-(2-amino-4-chloroimidazo[4,5-c]pyridin-3-yl)-1-phenylheptyl] carbamate |
|---|---|
| PubChem CID | 175521030 |
| Molecular Formula | C20H24ClN5O2 |
| Molecular Weight | 401.90 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | [6-(2-amino-4-chloroimidazo[4,5-c]pyridin-3-yl)-1-phenylheptyl] carbamate |
| SMILES | CC(CCCCC(OC(N)=O)c1ccccc1)n1c(N)nc2ccnc(Cl)c21 |
| InChI | InChI=1S/C20H24ClN5O2/c1-13(26-17-15(25-19(26)22)11-12-24-18(17)21)7-5-6-10-16(28-20(23)27)14-8-3-2-4-9-14/h2-4,8-9,11-13,16H,5-7,10H2,1H3,(H2,22,25)(H2,23,27) |
| InChIKey | FOIKWSLODYLZCN-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 109.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.90 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|