C41H46N2O8 — CID 175526537
dibenzyl 2-[3-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]propylamino]pentanedioate (PubChem CID 175526537) has the molecular formula C41H46N2O8 and a molecular weight of 694.83 g/mol. Its IUPAC name is dibenzyl 2-[3-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]propylamino]pentanedioate.
| Compound Name | dibenzyl 2-[3-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]propylamino]pentanedioate |
|---|---|
| PubChem CID | 175526537 |
| Molecular Formula | C41H46N2O8 |
| Molecular Weight | 694.83 g/mol |
| Exact Mass | 694.33 |
| IUPAC Name | dibenzyl 2-[3-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]propylamino]pentanedioate |
| SMILES | O=C(CCC(NCCCOCCOCCNC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C41H46N2O8/c44-39(49-28-31-12-3-1-4-13-31)21-20-38(40(45)50-29-32-14-5-2-6-15-32)42-22-11-24-47-26-27-48-25-23-43-41(46)51-30-37-35-18-9-7-16-33(35)34-17-8-10-19-36(34)37/h1-10,12-19,37-38,42H,11,20-30H2,(H,43,46) |
| InChIKey | PQEQRWZCYATNMF-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 121.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.83 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|