About 4-hydroxy-2-methylidenebutanoic acid;nitric acid
4-hydroxy-2-methylidenebutanoic acid;nitric acid (PubChem CID 175526871) has the molecular formula C5H9NO6
and a molecular weight of 179.13 g/mol. Its IUPAC name is 4-hydroxy-2-methylidenebutanoic acid;nitric acid.
Molecular Properties
| Compound Name | 4-hydroxy-2-methylidenebutanoic acid;nitric acid |
| PubChem CID | 175526871 |
| Molecular Formula | C5H9NO6 |
| Molecular Weight | 179.13 g/mol |
| Exact Mass | 179.04 |
| IUPAC Name | 4-hydroxy-2-methylidenebutanoic acid;nitric acid |
| SMILES | C=C(CCO)C(=O)O.O=[N+]([O-])O |
| InChI | InChI=1S/C5H8O3.HNO3/c1-4(2-3-6)5(7)8;2-1(3)4/h6H,1-3H2,(H,7,8);(H,2,3,4) |
| InChIKey | NSOWKUHEJSCTEC-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 120.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.13 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxy-2-methylidenebutanoic acid;nitric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-2-methylidenebutanoic acid;nitric acid?
The IUPAC name of 4-hydroxy-2-methylidenebutanoic acid;nitric acid (CID 175526871) is 4-hydroxy-2-methylidenebutanoic acid;nitric acid.
What is the SMILES notation for 4-hydroxy-2-methylidenebutanoic acid;nitric acid?
The canonical SMILES for 4-hydroxy-2-methylidenebutanoic acid;nitric acid is C=C(CCO)C(=O)O.O=[N+]([O-])O.
What is the InChIKey of 4-hydroxy-2-methylidenebutanoic acid;nitric acid?
The InChIKey is NSOWKUHEJSCTEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O3.HNO3/c1-4(2-3-6)5(7)8;2-1(3)4/h6H,1-3H2,(H,7,8);(H,2,3,4).
What are the key properties of 4-hydroxy-2-methylidenebutanoic acid;nitric acid?
4-hydroxy-2-methylidenebutanoic acid;nitric acid has a molecular weight of 179.13 g/mol, XLogP of -0.34, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-2-methylidenebutanoic acid;nitric acid is sourced from PubChem (CID 175526871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).