C20H21N — CID 175530091
4-(2,2-diphenylethyl)-1-methyl-2H-pyridine (PubChem CID 175530091) has the molecular formula C20H21N and a molecular weight of 275.40 g/mol. Its IUPAC name is 4-(2,2-diphenylethyl)-1-methyl-2H-pyridine.
| Compound Name | 4-(2,2-diphenylethyl)-1-methyl-2H-pyridine |
|---|---|
| PubChem CID | 175530091 |
| Molecular Formula | C20H21N |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | 4-(2,2-diphenylethyl)-1-methyl-2H-pyridine |
| SMILES | CN1C=CC(CC(c2ccccc2)c2ccccc2)=CC1 |
| InChI | InChI=1S/C20H21N/c1-21-14-12-17(13-15-21)16-20(18-8-4-2-5-9-18)19-10-6-3-7-11-19/h2-14,20H,15-16H2,1H3 |
| InChIKey | NUQPORUMLFMNEV-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |