C40H76N2O5S — CID 175534509
heptyl 4-[3-[cyclobutylmethyl(methyl)amino]propylsulfanylcarbonyl-(4-oxo-4-pentadecan-8-yloxybutyl)amino]butanoate (PubChem CID 175534509) has the molecular formula C40H76N2O5S and a molecular weight of 697.12 g/mol. Its IUPAC name is heptyl 4-[3-[cyclobutylmethyl(methyl)amino]propylsulfanylcarbonyl-(4-oxo-4-pentadecan-8-yloxybutyl)amino]butanoate.
| Compound Name | heptyl 4-[3-[cyclobutylmethyl(methyl)amino]propylsulfanylcarbonyl-(4-oxo-4-pentadecan-8-yloxybutyl)amino]butanoate |
|---|---|
| PubChem CID | 175534509 |
| Molecular Formula | C40H76N2O5S |
| Molecular Weight | 697.12 g/mol |
| Exact Mass | 696.55 |
| IUPAC Name | heptyl 4-[3-[cyclobutylmethyl(methyl)amino]propylsulfanylcarbonyl-(4-oxo-4-pentadecan-8-yloxybutyl)amino]butanoate |
| SMILES | CCCCCCCOC(=O)CCCN(CCCC(=O)OC(CCCCCCC)CCCCCCC)C(=O)SCCCN(C)CC1CCC1 |
| InChI | InChI=1S/C40H76N2O5S/c1-5-8-11-14-17-26-37(27-18-15-12-9-6-2)47-39(44)29-22-32-42(31-21-28-38(43)46-33-19-16-13-10-7-3)40(45)48-34-23-30-41(4)35-36-24-20-25-36/h36-37H,5-35H2,1-4H3 |
| InChIKey | YZJKIGQCGDKLKJ-UHFFFAOYSA-N |
| XLogP | 10.97 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.12 |
| LogP ≤ 5 | 10.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|