C12H11F3N2OS — CID 175536900
2-imino-3-[2-(2,3,3-trifluoropropyl)phenyl]-1,3-thiazolidin-4-one (PubChem CID 175536900) has the molecular formula C12H11F3N2OS and a molecular weight of 288.29 g/mol. Its IUPAC name is 2-imino-3-[2-(2,3,3-trifluoropropyl)phenyl]-1,3-thiazolidin-4-one.
| Compound Name | 2-imino-3-[2-(2,3,3-trifluoropropyl)phenyl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 175536900 |
| Molecular Formula | C12H11F3N2OS |
| Molecular Weight | 288.29 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | 2-imino-3-[2-(2,3,3-trifluoropropyl)phenyl]-1,3-thiazolidin-4-one |
| SMILES | [H]/N=C1\SCC(=O)N1c1ccccc1CC(F)C(F)F |
| InChI | InChI=1S/C12H11F3N2OS/c13-8(11(14)15)5-7-3-1-2-4-9(7)17-10(18)6-19-12(17)16/h1-4,8,11,16H,5-6H2/b16-12- |
| InChIKey | VNEAJPYIUGTULL-VBKFSLOCSA-N |
| XLogP | 2.85 |
| TPSA | 44.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.29 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|