C19H17N3O2S2 — CID 155580514
3-[2-(1,3-benzothiazol-2-ylmethoxymethyl)-5-methylphenyl]-2-imino-1,3-thiazolidin-4-one (PubChem CID 155580514) has the molecular formula C19H17N3O2S2 and a molecular weight of 383.50 g/mol. Its IUPAC name is 3-[2-(1,3-benzothiazol-2-ylmethoxymethyl)-5-methylphenyl]-2-imino-1,3-thiazolidin-4-one.
| Compound Name | 3-[2-(1,3-benzothiazol-2-ylmethoxymethyl)-5-methylphenyl]-2-imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 155580514 |
| Molecular Formula | C19H17N3O2S2 |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | 3-[2-(1,3-benzothiazol-2-ylmethoxymethyl)-5-methylphenyl]-2-imino-1,3-thiazolidin-4-one |
| SMILES | [H]/N=C1\SCC(=O)N1c1cc(C)ccc1COCc1nc2ccccc2s1 |
| InChI | InChI=1S/C19H17N3O2S2/c1-12-6-7-13(15(8-12)22-18(23)11-25-19(22)20)9-24-10-17-21-14-4-2-3-5-16(14)26-17/h2-8,20H,9-11H2,1H3/b20-19- |
| InChIKey | CMPHZRNQVRDDLH-VXPUYCOJSA-N |
| XLogP | 4.34 |
| TPSA | 66.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|