C15H20N2O2S — CID 178018157
2-imino-3-[5-methyl-2-(2-methylpropoxymethyl)phenyl]-1,3-thiazolidin-4-one (PubChem CID 178018157) has the molecular formula C15H20N2O2S and a molecular weight of 292.40 g/mol. Its IUPAC name is 2-imino-3-[5-methyl-2-(2-methylpropoxymethyl)phenyl]-1,3-thiazolidin-4-one.
| Compound Name | 2-imino-3-[5-methyl-2-(2-methylpropoxymethyl)phenyl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 178018157 |
| Molecular Formula | C15H20N2O2S |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 2-imino-3-[5-methyl-2-(2-methylpropoxymethyl)phenyl]-1,3-thiazolidin-4-one |
| SMILES | [H]/N=C1\SCC(=O)N1c1cc(C)ccc1COCC(C)C |
| InChI | InChI=1S/C15H20N2O2S/c1-10(2)7-19-8-12-5-4-11(3)6-13(12)17-14(18)9-20-15(17)16/h4-6,10,16H,7-9H2,1-3H3/b16-15- |
| InChIKey | SSZYSUGCYBJCPZ-NXVVXOECSA-N |
| XLogP | 3.18 |
| TPSA | 53.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|