C10H12ClIN3+ — CID 175537363
N-[(2-chlorophenyl)methyl]-2,3-didehydro-4,5-dihydroimidazol-3-ium-1-amine;hydroiodide (PubChem CID 175537363) has the molecular formula C10H12ClIN3+ and a molecular weight of 336.58 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-2,3-didehydro-4,5-dihydroimidazol-3-ium-1-amine;hydroiodide.
| Compound Name | N-[(2-chlorophenyl)methyl]-2,3-didehydro-4,5-dihydroimidazol-3-ium-1-amine;hydroiodide |
|---|---|
| PubChem CID | 175537363 |
| Molecular Formula | C10H12ClIN3+ |
| Molecular Weight | 336.58 g/mol |
| Exact Mass | 335.98 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-2,3-didehydro-4,5-dihydroimidazol-3-ium-1-amine;hydroiodide |
| SMILES | Clc1ccccc1CNN1C#[N+]CC1.I |
| InChI | InChI=1S/C10H11ClN3.HI/c11-10-4-2-1-3-9(10)7-13-14-6-5-12-8-14;/h1-4,13H,5-7H2;1H/q+1; |
| InChIKey | AHJRWSGAYNNYAL-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 19.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.58 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|