C5H8ClN3O2 — CID 175538875
4-[2-(chloroamino)-1-hydroxyethyl]-1,3-dihydroimidazol-2-one (PubChem CID 175538875) has the molecular formula C5H8ClN3O2 and a molecular weight of 177.59 g/mol. Its IUPAC name is 4-[2-(chloroamino)-1-hydroxyethyl]-1,3-dihydroimidazol-2-one.
| Compound Name | 4-[2-(chloroamino)-1-hydroxyethyl]-1,3-dihydroimidazol-2-one |
|---|---|
| PubChem CID | 175538875 |
| Molecular Formula | C5H8ClN3O2 |
| Molecular Weight | 177.59 g/mol |
| Exact Mass | 177.03 |
| IUPAC Name | 4-[2-(chloroamino)-1-hydroxyethyl]-1,3-dihydroimidazol-2-one |
| SMILES | O=c1[nH]cc(C(O)CNCl)[nH]1 |
| InChI | InChI=1S/C5H8ClN3O2/c6-8-2-4(10)3-1-7-5(11)9-3/h1,4,8,10H,2H2,(H2,7,9,11) |
| InChIKey | CSOPCAXKFZJSDX-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.59 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|