C45H86O8 — CID 175541894
(2R,3R,4S,5R,6R)-2-[2,3-bis[(Z)-octadec-9-enoxy]propoxy]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 175541894) has the molecular formula C45H86O8 and a molecular weight of 755.17 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-2-[2,3-bis[(Z)-octadec-9-enoxy]propoxy]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5R,6R)-2-[2,3-bis[(Z)-octadec-9-enoxy]propoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 175541894 |
| Molecular Formula | C45H86O8 |
| Molecular Weight | 755.17 g/mol |
| Exact Mass | 754.63 |
| IUPAC Name | (2R,3R,4S,5R,6R)-2-[2,3-bis[(Z)-octadec-9-enoxy]propoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CCCCCCCC/C=C\CCCCCCCCOCC(CO[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O)OCCCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C45H86O8/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-50-38-40(39-52-45-44(49)43(48)42(47)41(37-46)53-45)51-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20,40-49H,3-16,21-39H2,1-2H3/b19-17-,20-18-/t40?,41-,42+,43+,44-,45-/m1/s1 |
| InChIKey | RWCDMMILUSDHCB-OTKWJKSESA-N |
| XLogP | 10.28 |
| TPSA | 117.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.17 |
| LogP ≤ 5 | 10.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|