About [1-(1H-imidazol-2-yl)-2,2-dimethylpropyl] carbamate
[1-(1H-imidazol-2-yl)-2,2-dimethylpropyl] carbamate (PubChem CID 175546665) has the molecular formula C9H15N3O2
and a molecular weight of 197.24 g/mol. Its IUPAC name is [1-(1H-imidazol-2-yl)-2,2-dimethylpropyl] carbamate.
Molecular Properties
| Compound Name | [1-(1H-imidazol-2-yl)-2,2-dimethylpropyl] carbamate |
| PubChem CID | 175546665 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | [1-(1H-imidazol-2-yl)-2,2-dimethylpropyl] carbamate |
| SMILES | CC(C)(C)C(OC(N)=O)c1ncc[nH]1 |
| InChI | InChI=1S/C9H15N3O2/c1-9(2,3)6(14-8(10)13)7-11-4-5-12-7/h4-6H,1-3H3,(H2,10,13)(H,11,12) |
| InChIKey | KPGLFBIVWUUXNY-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1-(1H-imidazol-2-yl)-2,2-dimethylpropyl] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(1H-imidazol-2-yl)-2,2-dimethylpropyl] carbamate?
The IUPAC name of [1-(1H-imidazol-2-yl)-2,2-dimethylpropyl] carbamate (CID 175546665) is [1-(1H-imidazol-2-yl)-2,2-dimethylpropyl] carbamate.
What is the SMILES notation for [1-(1H-imidazol-2-yl)-2,2-dimethylpropyl] carbamate?
The canonical SMILES for [1-(1H-imidazol-2-yl)-2,2-dimethylpropyl] carbamate is CC(C)(C)C(OC(N)=O)c1ncc[nH]1.
What is the InChIKey of [1-(1H-imidazol-2-yl)-2,2-dimethylpropyl] carbamate?
The InChIKey is KPGLFBIVWUUXNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O2/c1-9(2,3)6(14-8(10)13)7-11-4-5-12-7/h4-6H,1-3H3,(H2,10,13)(H,11,12).
What are the key properties of [1-(1H-imidazol-2-yl)-2,2-dimethylpropyl] carbamate?
[1-(1H-imidazol-2-yl)-2,2-dimethylpropyl] carbamate has a molecular weight of 197.24 g/mol, XLogP of 1.59, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(1H-imidazol-2-yl)-2,2-dimethylpropyl] carbamate is sourced from PubChem (CID 175546665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).