C10H15N3O2 — CID 175600626
(2,2-dimethyl-1-pyrimidin-2-ylpropyl) carbamate (PubChem CID 175600626) has the molecular formula C10H15N3O2 and a molecular weight of 209.25 g/mol. Its IUPAC name is (2,2-dimethyl-1-pyrimidin-2-ylpropyl) carbamate.
| Compound Name | (2,2-dimethyl-1-pyrimidin-2-ylpropyl) carbamate |
|---|---|
| PubChem CID | 175600626 |
| Molecular Formula | C10H15N3O2 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | (2,2-dimethyl-1-pyrimidin-2-ylpropyl) carbamate |
| SMILES | CC(C)(C)C(OC(N)=O)c1ncccn1 |
| InChI | InChI=1S/C10H15N3O2/c1-10(2,3)7(15-9(11)14)8-12-5-4-6-13-8/h4-7H,1-3H3,(H2,11,14) |
| InChIKey | FNLKIVSTSMBMON-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |