C11H16N2O3 — CID 151152151
[2,2-dimethyl-1-(1-oxidopyridin-1-ium-4-yl)propyl] carbamate (PubChem CID 151152151) has the molecular formula C11H16N2O3 and a molecular weight of 224.26 g/mol. Its IUPAC name is [2,2-dimethyl-1-(1-oxidopyridin-1-ium-4-yl)propyl] carbamate.
| Compound Name | [2,2-dimethyl-1-(1-oxidopyridin-1-ium-4-yl)propyl] carbamate |
|---|---|
| PubChem CID | 151152151 |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | [2,2-dimethyl-1-(1-oxidopyridin-1-ium-4-yl)propyl] carbamate |
| SMILES | CC(C)(C)C(OC(N)=O)c1cc[n+]([O-])cc1 |
| InChI | InChI=1S/C11H16N2O3/c1-11(2,3)9(16-10(12)14)8-4-6-13(15)7-5-8/h4-7,9H,1-3H3,(H2,12,14) |
| InChIKey | MYLFAZQUTMLPIT-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|