C13H18BrNO4S — CID 67188734
[1-[4-(bromomethyl)phenyl]sulfonyl-2,2-dimethylpropyl] carbamate (PubChem CID 67188734) has the molecular formula C13H18BrNO4S and a molecular weight of 364.26 g/mol. Its IUPAC name is [1-[4-(bromomethyl)phenyl]sulfonyl-2,2-dimethylpropyl] carbamate.
| Compound Name | [1-[4-(bromomethyl)phenyl]sulfonyl-2,2-dimethylpropyl] carbamate |
|---|---|
| PubChem CID | 67188734 |
| Molecular Formula | C13H18BrNO4S |
| Molecular Weight | 364.26 g/mol |
| Exact Mass | 363.01 |
| IUPAC Name | [1-[4-(bromomethyl)phenyl]sulfonyl-2,2-dimethylpropyl] carbamate |
| SMILES | CC(C)(C)C(OC(N)=O)S(=O)(=O)c1ccc(CBr)cc1 |
| InChI | InChI=1S/C13H18BrNO4S/c1-13(2,3)11(19-12(15)16)20(17,18)10-6-4-9(8-14)5-7-10/h4-7,11H,8H2,1-3H3,(H2,15,16) |
| InChIKey | UKHCBGROJTUBGP-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.26 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|