About carbonochloridoyl 3-(9H-fluoren-9-yl)-2-methylprop-2-enoate
carbonochloridoyl 3-(9H-fluoren-9-yl)-2-methylprop-2-enoate (PubChem CID 175546905) has the molecular formula C18H13ClO3
and a molecular weight of 312.75 g/mol. Its IUPAC name is carbonochloridoyl 3-(9H-fluoren-9-yl)-2-methylprop-2-enoate.
Molecular Properties
| Compound Name | carbonochloridoyl 3-(9H-fluoren-9-yl)-2-methylprop-2-enoate |
| PubChem CID | 175546905 |
| Molecular Formula | C18H13ClO3 |
| Molecular Weight | 312.75 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | carbonochloridoyl 3-(9H-fluoren-9-yl)-2-methylprop-2-enoate |
| SMILES | CC(=CC1c2ccccc2-c2ccccc21)C(=O)OC(=O)Cl |
| InChI | InChI=1S/C18H13ClO3/c1-11(17(20)22-18(19)21)10-16-14-8-4-2-6-12(14)13-7-3-5-9-15(13)16/h2-10,16H,1H3 |
| InChIKey | KQGNDPIFESTEJH-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.75 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze carbonochloridoyl 3-(9H-fluoren-9-yl)-2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbonochloridoyl 3-(9H-fluoren-9-yl)-2-methylprop-2-enoate?
The IUPAC name of carbonochloridoyl 3-(9H-fluoren-9-yl)-2-methylprop-2-enoate (CID 175546905) is carbonochloridoyl 3-(9H-fluoren-9-yl)-2-methylprop-2-enoate.
What is the SMILES notation for carbonochloridoyl 3-(9H-fluoren-9-yl)-2-methylprop-2-enoate?
The canonical SMILES for carbonochloridoyl 3-(9H-fluoren-9-yl)-2-methylprop-2-enoate is CC(=CC1c2ccccc2-c2ccccc21)C(=O)OC(=O)Cl.
What is the InChIKey of carbonochloridoyl 3-(9H-fluoren-9-yl)-2-methylprop-2-enoate?
The InChIKey is KQGNDPIFESTEJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13ClO3/c1-11(17(20)22-18(19)21)10-16-14-8-4-2-6-12(14)13-7-3-5-9-15(13)16/h2-10,16H,1H3.
What are the key properties of carbonochloridoyl 3-(9H-fluoren-9-yl)-2-methylprop-2-enoate?
carbonochloridoyl 3-(9H-fluoren-9-yl)-2-methylprop-2-enoate has a molecular weight of 312.75 g/mol, XLogP of 4.65, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for carbonochloridoyl 3-(9H-fluoren-9-yl)-2-methylprop-2-enoate is sourced from PubChem (CID 175546905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).