C24H21ClO6 — CID 54393573
carbonochloridoyl [1-(9H-fluoren-9-yl)-3-hexa-1,3-dienoxy-2-oxopropyl] carbonate (PubChem CID 54393573) has the molecular formula C24H21ClO6 and a molecular weight of 440.88 g/mol. Its IUPAC name is carbonochloridoyl [1-(9H-fluoren-9-yl)-3-hexa-1,3-dienoxy-2-oxopropyl] carbonate.
| Compound Name | carbonochloridoyl [1-(9H-fluoren-9-yl)-3-hexa-1,3-dienoxy-2-oxopropyl] carbonate |
|---|---|
| PubChem CID | 54393573 |
| Molecular Formula | C24H21ClO6 |
| Molecular Weight | 440.88 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | carbonochloridoyl [1-(9H-fluoren-9-yl)-3-hexa-1,3-dienoxy-2-oxopropyl] carbonate |
| SMILES | CCC=CC=COCC(=O)C(OC(=O)OC(=O)Cl)C1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C24H21ClO6/c1-2-3-4-9-14-29-15-20(26)22(30-24(28)31-23(25)27)21-18-12-7-5-10-16(18)17-11-6-8-13-19(17)21/h3-14,21-22H,2,15H2,1H3 |
| InChIKey | VIJAEBHSEMCVAZ-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.88 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|