C6H10N4O2 — CID 175549866
(4-propan-2-yl-1,2,4-triazol-3-yl) carbamate (PubChem CID 175549866) has the molecular formula C6H10N4O2 and a molecular weight of 170.17 g/mol. Its IUPAC name is (4-propan-2-yl-1,2,4-triazol-3-yl) carbamate.
| Compound Name | (4-propan-2-yl-1,2,4-triazol-3-yl) carbamate |
|---|---|
| PubChem CID | 175549866 |
| Molecular Formula | C6H10N4O2 |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.08 |
| IUPAC Name | (4-propan-2-yl-1,2,4-triazol-3-yl) carbamate |
| SMILES | CC(C)n1cnnc1OC(N)=O |
| InChI | InChI=1S/C6H10N4O2/c1-4(2)10-3-8-9-6(10)12-5(7)11/h3-4H,1-2H3,(H2,7,11) |
| InChIKey | LIBOBHOOMUDIEO-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |