C5H8BrN3 — CID 155819679
3-bromo-4-propan-2-yl-1,2,4-triazole (PubChem CID 155819679) has the molecular formula C5H8BrN3 and a molecular weight of 190.04 g/mol. Its IUPAC name is 3-bromo-4-propan-2-yl-1,2,4-triazole.
| Compound Name | 3-bromo-4-propan-2-yl-1,2,4-triazole |
|---|---|
| PubChem CID | 155819679 |
| Molecular Formula | C5H8BrN3 |
| Molecular Weight | 190.04 g/mol |
| Exact Mass | 188.99 |
| IUPAC Name | 3-bromo-4-propan-2-yl-1,2,4-triazole |
| SMILES | CC(C)n1cnnc1Br |
| InChI | InChI=1S/C5H8BrN3/c1-4(2)9-3-7-8-5(9)6/h3-4H,1-2H3 |
| InChIKey | UVQIBNPAYRQNLP-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.04 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |