C11H15N5O — CID 175551730
5,6-dimethyl-1-phenyl-2H-tetrazine;formamide (PubChem CID 175551730) has the molecular formula C11H15N5O and a molecular weight of 233.28 g/mol. Its IUPAC name is 5,6-dimethyl-1-phenyl-2H-tetrazine;formamide.
| Compound Name | 5,6-dimethyl-1-phenyl-2H-tetrazine;formamide |
|---|---|
| PubChem CID | 175551730 |
| Molecular Formula | C11H15N5O |
| Molecular Weight | 233.28 g/mol |
| Exact Mass | 233.13 |
| IUPAC Name | 5,6-dimethyl-1-phenyl-2H-tetrazine;formamide |
| SMILES | CC1=C(C)N(c2ccccc2)NN=N1.NC=O |
| InChI | InChI=1S/C10H12N4.CH3NO/c1-8-9(2)14(13-12-11-8)10-6-4-3-5-7-10;2-1-3/h3-7H,1-2H3,(H,11,13);1H,(H2,2,3) |
| InChIKey | LDAOZTQOKHIUGF-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 83.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.28 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|