C31H51F3O2S — CID 175552303
[4,4,10,13,14-pentamethyl-17-(6-methylhept-5-en-2-yl)-2,3,5,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] trifluoromethanesulfinate (PubChem CID 175552303) has the molecular formula C31H51F3O2S and a molecular weight of 544.81 g/mol. Its IUPAC name is [4,4,10,13,14-pentamethyl-17-(6-methylhept-5-en-2-yl)-2,3,5,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] trifluoromethanesulfinate.
| Compound Name | [4,4,10,13,14-pentamethyl-17-(6-methylhept-5-en-2-yl)-2,3,5,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] trifluoromethanesulfinate |
|---|---|
| PubChem CID | 175552303 |
| Molecular Formula | C31H51F3O2S |
| Molecular Weight | 544.81 g/mol |
| Exact Mass | 544.36 |
| IUPAC Name | [4,4,10,13,14-pentamethyl-17-(6-methylhept-5-en-2-yl)-2,3,5,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] trifluoromethanesulfinate |
| SMILES | CC(C)=CCCC(C)C1CCC2(C)C3CCC4C(C)(C)C(OS(=O)C(F)(F)F)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C31H51F3O2S/c1-20(2)10-9-11-21(3)22-14-18-30(8)24-12-13-25-27(4,5)26(36-37(35)31(32,33)34)16-17-28(25,6)23(24)15-19-29(22,30)7/h10,21-26H,9,11-19H2,1-8H3 |
| InChIKey | BYEWJXQQSLDMKG-UHFFFAOYSA-N |
| XLogP | 9.62 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.81 |
| LogP ≤ 5 | 9.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|