C11H15NO4S — CID 175552480
methyl 4-methyl-2-[(4R)-1,3-oxazolidin-4-yl]benzenesulfonate (PubChem CID 175552480) has the molecular formula C11H15NO4S and a molecular weight of 257.31 g/mol. Its IUPAC name is methyl 4-methyl-2-[(4R)-1,3-oxazolidin-4-yl]benzenesulfonate.
| Compound Name | methyl 4-methyl-2-[(4R)-1,3-oxazolidin-4-yl]benzenesulfonate |
|---|---|
| PubChem CID | 175552480 |
| Molecular Formula | C11H15NO4S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | methyl 4-methyl-2-[(4R)-1,3-oxazolidin-4-yl]benzenesulfonate |
| SMILES | COS(=O)(=O)c1ccc(C)cc1[C@@H]1COCN1 |
| InChI | InChI=1S/C11H15NO4S/c1-8-3-4-11(17(13,14)15-2)9(5-8)10-6-16-7-12-10/h3-5,10,12H,6-7H2,1-2H3/t10-/m0/s1 |
| InChIKey | OEFSNVLDWWECKC-JTQLQIEISA-N |
| XLogP | 0.95 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|