C20H25NO3S — CID 118354888
methyl 2-[(3S,5R)-1-benzyl-5-methylpyrrolidin-3-yl]-4-methylbenzenesulfonate (PubChem CID 118354888) has the molecular formula C20H25NO3S and a molecular weight of 359.49 g/mol. Its IUPAC name is methyl 2-[(3S,5R)-1-benzyl-5-methylpyrrolidin-3-yl]-4-methylbenzenesulfonate.
| Compound Name | methyl 2-[(3S,5R)-1-benzyl-5-methylpyrrolidin-3-yl]-4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 118354888 |
| Molecular Formula | C20H25NO3S |
| Molecular Weight | 359.49 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | methyl 2-[(3S,5R)-1-benzyl-5-methylpyrrolidin-3-yl]-4-methylbenzenesulfonate |
| SMILES | COS(=O)(=O)c1ccc(C)cc1[C@@H]1C[C@@H](C)N(Cc2ccccc2)C1 |
| InChI | InChI=1S/C20H25NO3S/c1-15-9-10-20(25(22,23)24-3)19(11-15)18-12-16(2)21(14-18)13-17-7-5-4-6-8-17/h4-11,16,18H,12-14H2,1-3H3/t16-,18-/m1/s1 |
| InChIKey | DDKSPDHCZPBQNC-SJLPKXTDSA-N |
| XLogP | 3.71 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.49 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|