C20H25NO3S — CID 118367537
3-[(3R,5R)-1-benzyl-5-methylpyrrolidin-3-yl]-2,4-dimethylbenzenesulfonic acid (PubChem CID 118367537) has the molecular formula C20H25NO3S and a molecular weight of 359.49 g/mol. Its IUPAC name is 3-[(3R,5R)-1-benzyl-5-methylpyrrolidin-3-yl]-2,4-dimethylbenzenesulfonic acid.
| Compound Name | 3-[(3R,5R)-1-benzyl-5-methylpyrrolidin-3-yl]-2,4-dimethylbenzenesulfonic acid |
|---|---|
| PubChem CID | 118367537 |
| Molecular Formula | C20H25NO3S |
| Molecular Weight | 359.49 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | 3-[(3R,5R)-1-benzyl-5-methylpyrrolidin-3-yl]-2,4-dimethylbenzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)c(C)c1[C@H]1C[C@@H](C)N(Cc2ccccc2)C1 |
| InChI | InChI=1S/C20H25NO3S/c1-14-9-10-19(25(22,23)24)16(3)20(14)18-11-15(2)21(13-18)12-17-7-5-4-6-8-17/h4-10,15,18H,11-13H2,1-3H3,(H,22,23,24)/t15-,18+/m1/s1 |
| InChIKey | JNPTWOQZKDTRME-QAPCUYQASA-N |
| XLogP | 3.93 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.49 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|