C14H20O5S — CID 87407173
methyl 2-(2,2-dimethyl-1,3-dioxan-5-yl)-4-methylbenzenesulfonate (PubChem CID 87407173) has the molecular formula C14H20O5S and a molecular weight of 300.38 g/mol. Its IUPAC name is methyl 2-(2,2-dimethyl-1,3-dioxan-5-yl)-4-methylbenzenesulfonate.
| Compound Name | methyl 2-(2,2-dimethyl-1,3-dioxan-5-yl)-4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 87407173 |
| Molecular Formula | C14H20O5S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | methyl 2-(2,2-dimethyl-1,3-dioxan-5-yl)-4-methylbenzenesulfonate |
| SMILES | COS(=O)(=O)c1ccc(C)cc1C1COC(C)(C)OC1 |
| InChI | InChI=1S/C14H20O5S/c1-10-5-6-13(20(15,16)17-4)12(7-10)11-8-18-14(2,3)19-9-11/h5-7,11H,8-9H2,1-4H3 |
| InChIKey | GAXJOBCHILDWGH-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|