C13H16O5S — CID 19049213
methyl 2-(2,2-dimethyl-1,3-dioxol-4-yl)-4-methylbenzenesulfonate (PubChem CID 19049213) has the molecular formula C13H16O5S and a molecular weight of 284.33 g/mol. Its IUPAC name is methyl 2-(2,2-dimethyl-1,3-dioxol-4-yl)-4-methylbenzenesulfonate.
| Compound Name | methyl 2-(2,2-dimethyl-1,3-dioxol-4-yl)-4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 19049213 |
| Molecular Formula | C13H16O5S |
| Molecular Weight | 284.33 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | methyl 2-(2,2-dimethyl-1,3-dioxol-4-yl)-4-methylbenzenesulfonate |
| SMILES | COS(=O)(=O)c1ccc(C)cc1C1=COC(C)(C)O1 |
| InChI | InChI=1S/C13H16O5S/c1-9-5-6-12(19(14,15)16-4)10(7-9)11-8-17-13(2,3)18-11/h5-8H,1-4H3 |
| InChIKey | LJPCSMHDIWZWFF-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.33 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|