C17H17ClO5S — CID 91613466
methyl 2-(5-chloro-7-hydroxy-2-methyl-3H-1-benzofuran-2-yl)-4-methylbenzenesulfonate (PubChem CID 91613466) has the molecular formula C17H17ClO5S and a molecular weight of 368.84 g/mol. Its IUPAC name is methyl 2-(5-chloro-7-hydroxy-2-methyl-3H-1-benzofuran-2-yl)-4-methylbenzenesulfonate.
| Compound Name | methyl 2-(5-chloro-7-hydroxy-2-methyl-3H-1-benzofuran-2-yl)-4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 91613466 |
| Molecular Formula | C17H17ClO5S |
| Molecular Weight | 368.84 g/mol |
| Exact Mass | 368.05 |
| IUPAC Name | methyl 2-(5-chloro-7-hydroxy-2-methyl-3H-1-benzofuran-2-yl)-4-methylbenzenesulfonate |
| SMILES | COS(=O)(=O)c1ccc(C)cc1C1(C)Cc2cc(Cl)cc(O)c2O1 |
| InChI | InChI=1S/C17H17ClO5S/c1-10-4-5-15(24(20,21)22-3)13(6-10)17(2)9-11-7-12(18)8-14(19)16(11)23-17/h4-8,19H,9H2,1-3H3 |
| InChIKey | XQKHFHBKAJMZQH-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.84 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|