C19H22O8S2 — CID 175731877
2-[(4S,5S)-2,2-dimethyl-5-(5-methyl-2-sulfophenyl)-1,3-dioxolan-4-yl]-4-methylbenzenesulfonic acid (PubChem CID 175731877) has the molecular formula C19H22O8S2 and a molecular weight of 442.51 g/mol. Its IUPAC name is 2-[(4S,5S)-2,2-dimethyl-5-(5-methyl-2-sulfophenyl)-1,3-dioxolan-4-yl]-4-methylbenzenesulfonic acid.
| Compound Name | 2-[(4S,5S)-2,2-dimethyl-5-(5-methyl-2-sulfophenyl)-1,3-dioxolan-4-yl]-4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 175731877 |
| Molecular Formula | C19H22O8S2 |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.08 |
| IUPAC Name | 2-[(4S,5S)-2,2-dimethyl-5-(5-methyl-2-sulfophenyl)-1,3-dioxolan-4-yl]-4-methylbenzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)c([C@@H]2OC(C)(C)O[C@H]2c2cc(C)ccc2S(=O)(=O)O)c1 |
| InChI | InChI=1S/C19H22O8S2/c1-11-5-7-15(28(20,21)22)13(9-11)17-18(27-19(3,4)26-17)14-10-12(2)6-8-16(14)29(23,24)25/h5-10,17-18H,1-4H3,(H,20,21,22)(H,23,24,25)/t17-,18-/m0/s1 |
| InChIKey | WNEMFVWRNVBTCH-ROUUACIJSA-N |
| XLogP | 3.36 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|