C12H15NO4S — CID 175222238
2-(5,5-dimethyl-4H-1,2-oxazol-3-yl)-4-methylbenzenesulfonic acid (PubChem CID 175222238) has the molecular formula C12H15NO4S and a molecular weight of 269.32 g/mol. Its IUPAC name is 2-(5,5-dimethyl-4H-1,2-oxazol-3-yl)-4-methylbenzenesulfonic acid.
| Compound Name | 2-(5,5-dimethyl-4H-1,2-oxazol-3-yl)-4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 175222238 |
| Molecular Formula | C12H15NO4S |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | 2-(5,5-dimethyl-4H-1,2-oxazol-3-yl)-4-methylbenzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)c(C2=NOC(C)(C)C2)c1 |
| InChI | InChI=1S/C12H15NO4S/c1-8-4-5-11(18(14,15)16)9(6-8)10-7-12(2,3)17-13-10/h4-6H,7H2,1-3H3,(H,14,15,16) |
| InChIKey | GIYWJZJOMLMIAK-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|