C13H19NO4S — CID 90929101
2-[(3R)-3-ethylmorpholin-2-yl]-4-methylbenzenesulfonic acid (PubChem CID 90929101) has the molecular formula C13H19NO4S and a molecular weight of 285.36 g/mol. Its IUPAC name is 2-[(3R)-3-ethylmorpholin-2-yl]-4-methylbenzenesulfonic acid.
| Compound Name | 2-[(3R)-3-ethylmorpholin-2-yl]-4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 90929101 |
| Molecular Formula | C13H19NO4S |
| Molecular Weight | 285.36 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 2-[(3R)-3-ethylmorpholin-2-yl]-4-methylbenzenesulfonic acid |
| SMILES | CC[C@H]1NCCOC1c1cc(C)ccc1S(=O)(=O)O |
| InChI | InChI=1S/C13H19NO4S/c1-3-11-13(18-7-6-14-11)10-8-9(2)4-5-12(10)19(15,16)17/h4-5,8,11,13-14H,3,6-7H2,1-2H3,(H,15,16,17)/t11-,13?/m1/s1 |
| InChIKey | FCKUDKGRVRTWPS-JTDNENJMSA-N |
| XLogP | 1.68 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.36 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|