C15H20F2O3S — CID 87922011
ethyl 2-(4,4-difluorocyclohexyl)-4-methylbenzenesulfonate (PubChem CID 87922011) has the molecular formula C15H20F2O3S and a molecular weight of 318.39 g/mol. Its IUPAC name is ethyl 2-(4,4-difluorocyclohexyl)-4-methylbenzenesulfonate.
| Compound Name | ethyl 2-(4,4-difluorocyclohexyl)-4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 87922011 |
| Molecular Formula | C15H20F2O3S |
| Molecular Weight | 318.39 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | ethyl 2-(4,4-difluorocyclohexyl)-4-methylbenzenesulfonate |
| SMILES | CCOS(=O)(=O)c1ccc(C)cc1C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C15H20F2O3S/c1-3-20-21(18,19)14-5-4-11(2)10-13(14)12-6-8-15(16,17)9-7-12/h4-5,10,12H,3,6-9H2,1-2H3 |
| InChIKey | CPKWEMOHJGELDI-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.39 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|