C19H21O4S- — CID 86608347
4-methyl-2-[3-(phenylmethoxymethyl)cyclobutyl]benzenesulfonate (PubChem CID 86608347) has the molecular formula C19H21O4S- and a molecular weight of 345.44 g/mol. Its IUPAC name is 4-methyl-2-[3-(phenylmethoxymethyl)cyclobutyl]benzenesulfonate.
| Compound Name | 4-methyl-2-[3-(phenylmethoxymethyl)cyclobutyl]benzenesulfonate |
|---|---|
| PubChem CID | 86608347 |
| Molecular Formula | C19H21O4S- |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | 4-methyl-2-[3-(phenylmethoxymethyl)cyclobutyl]benzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)[O-])c(C2CC(COCc3ccccc3)C2)c1 |
| InChI | InChI=1S/C19H22O4S/c1-14-7-8-19(24(20,21)22)18(9-14)17-10-16(11-17)13-23-12-15-5-3-2-4-6-15/h2-9,16-17H,10-13H2,1H3,(H,20,21,22)/p-1 |
| InChIKey | ZASMMRCQTLVYBP-UHFFFAOYSA-M |
| XLogP | 3.61 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|