C19H21N3O6 — CID 175555486
5-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxo-4H-isoquinolin-4-yl]amino]pentanoic acid (PubChem CID 175555486) has the molecular formula C19H21N3O6 and a molecular weight of 387.39 g/mol. Its IUPAC name is 5-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxo-4H-isoquinolin-4-yl]amino]pentanoic acid.
| Compound Name | 5-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxo-4H-isoquinolin-4-yl]amino]pentanoic acid |
|---|---|
| PubChem CID | 175555486 |
| Molecular Formula | C19H21N3O6 |
| Molecular Weight | 387.39 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | 5-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxo-4H-isoquinolin-4-yl]amino]pentanoic acid |
| SMILES | O=C(O)CCCCNC1C(=O)N(C2CCC(=O)NC2=O)C(=O)c2ccccc21 |
| InChI | InChI=1S/C19H21N3O6/c23-14-9-8-13(17(26)21-14)22-18(27)12-6-2-1-5-11(12)16(19(22)28)20-10-4-3-7-15(24)25/h1-2,5-6,13,16,20H,3-4,7-10H2,(H,24,25)(H,21,23,26) |
| InChIKey | CFEPWKATAYKIBU-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.39 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|