C23H36O2 — CID 175556068
(E)-1-(3,7-dimethylocta-1,6-dien-3-yloxy)-4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-2-one (PubChem CID 175556068) has the molecular formula C23H36O2 and a molecular weight of 344.54 g/mol. Its IUPAC name is (E)-1-(3,7-dimethylocta-1,6-dien-3-yloxy)-4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-2-one.
| Compound Name | (E)-1-(3,7-dimethylocta-1,6-dien-3-yloxy)-4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-2-one |
|---|---|
| PubChem CID | 175556068 |
| Molecular Formula | C23H36O2 |
| Molecular Weight | 344.54 g/mol |
| Exact Mass | 344.27 |
| IUPAC Name | (E)-1-(3,7-dimethylocta-1,6-dien-3-yloxy)-4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-2-one |
| SMILES | C=CC(C)(CCC=C(C)C)OCC(=O)/C=C/C1C(C)=CCCC1(C)C |
| InChI | InChI=1S/C23H36O2/c1-8-23(7,16-9-11-18(2)3)25-17-20(24)13-14-21-19(4)12-10-15-22(21,5)6/h8,11-14,21H,1,9-10,15-17H2,2-7H3/b14-13+ |
| InChIKey | ZUBSEIQWJACSKZ-BUHFOSPRSA-N |
| XLogP | 6.20 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.54 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|