C19H29NO — CID 134262273
(E)-1-(1-ethenylpyrrolidin-2-yl)-4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-2-one (PubChem CID 134262273) has the molecular formula C19H29NO and a molecular weight of 287.45 g/mol. Its IUPAC name is (E)-1-(1-ethenylpyrrolidin-2-yl)-4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-2-one.
| Compound Name | (E)-1-(1-ethenylpyrrolidin-2-yl)-4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-2-one |
|---|---|
| PubChem CID | 134262273 |
| Molecular Formula | C19H29NO |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.22 |
| IUPAC Name | (E)-1-(1-ethenylpyrrolidin-2-yl)-4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-2-one |
| SMILES | C=CN1CCCC1CC(=O)/C=C/C1C(C)=CCCC1(C)C |
| InChI | InChI=1S/C19H29NO/c1-5-20-13-7-9-16(20)14-17(21)10-11-18-15(2)8-6-12-19(18,3)4/h5,8,10-11,16,18H,1,6-7,9,12-14H2,2-4H3/b11-10+ |
| InChIKey | GELPTDFTLAGQEV-ZHACJKMWSA-N |
| XLogP | 4.49 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|