C16H22O6 — CID 175557273
4-(3,8-dihydroxy-1-oxooctan-2-yl)oxy-3-methoxybenzaldehyde (PubChem CID 175557273) has the molecular formula C16H22O6 and a molecular weight of 310.35 g/mol. Its IUPAC name is 4-(3,8-dihydroxy-1-oxooctan-2-yl)oxy-3-methoxybenzaldehyde.
| Compound Name | 4-(3,8-dihydroxy-1-oxooctan-2-yl)oxy-3-methoxybenzaldehyde |
|---|---|
| PubChem CID | 175557273 |
| Molecular Formula | C16H22O6 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 4-(3,8-dihydroxy-1-oxooctan-2-yl)oxy-3-methoxybenzaldehyde |
| SMILES | COc1cc(C=O)ccc1OC(C=O)C(O)CCCCCO |
| InChI | InChI=1S/C16H22O6/c1-21-15-9-12(10-18)6-7-14(15)22-16(11-19)13(20)5-3-2-4-8-17/h6-7,9-11,13,16-17,20H,2-5,8H2,1H3 |
| InChIKey | PSRBOIFBXNLJJO-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|