C34H43NO4 — CID 175559233
dicyclohexylmethyl 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylpent-4-enoate (PubChem CID 175559233) has the molecular formula C34H43NO4 and a molecular weight of 529.72 g/mol. Its IUPAC name is dicyclohexylmethyl 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylpent-4-enoate.
| Compound Name | dicyclohexylmethyl 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylpent-4-enoate |
|---|---|
| PubChem CID | 175559233 |
| Molecular Formula | C34H43NO4 |
| Molecular Weight | 529.72 g/mol |
| Exact Mass | 529.32 |
| IUPAC Name | dicyclohexylmethyl 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylpent-4-enoate |
| SMILES | C=CC(C)C(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)OC(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C34H43NO4/c1-3-23(2)31(33(36)39-32(24-14-6-4-7-15-24)25-16-8-5-9-17-25)35-34(37)38-22-30-28-20-12-10-18-26(28)27-19-11-13-21-29(27)30/h3,10-13,18-21,23-25,30-32H,1,4-9,14-17,22H2,2H3,(H,35,37) |
| InChIKey | PFJTYSNOXIQDEN-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.72 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|