C15H16F5N3O4 — CID 175559386
methyl 2-nitro-4-[4-(1,2,2,3,3-pentafluoropropyl)piperazin-1-yl]benzoate (PubChem CID 175559386) has the molecular formula C15H16F5N3O4 and a molecular weight of 397.30 g/mol. Its IUPAC name is methyl 2-nitro-4-[4-(1,2,2,3,3-pentafluoropropyl)piperazin-1-yl]benzoate.
| Compound Name | methyl 2-nitro-4-[4-(1,2,2,3,3-pentafluoropropyl)piperazin-1-yl]benzoate |
|---|---|
| PubChem CID | 175559386 |
| Molecular Formula | C15H16F5N3O4 |
| Molecular Weight | 397.30 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | methyl 2-nitro-4-[4-(1,2,2,3,3-pentafluoropropyl)piperazin-1-yl]benzoate |
| SMILES | COC(=O)c1ccc(N2CCN(C(F)C(F)(F)C(F)F)CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H16F5N3O4/c1-27-12(24)10-3-2-9(8-11(10)23(25)26)21-4-6-22(7-5-21)14(18)15(19,20)13(16)17/h2-3,8,13-14H,4-7H2,1H3 |
| InChIKey | CSSBTYKJOOOMIY-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 75.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.30 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|