C16H16I2NO3P — CID 175561816
4-(3,6-diiodocarbazol-9-yl)butylphosphonic acid (PubChem CID 175561816) has the molecular formula C16H16I2NO3P and a molecular weight of 555.09 g/mol. Its IUPAC name is 4-(3,6-diiodocarbazol-9-yl)butylphosphonic acid.
| Compound Name | 4-(3,6-diiodocarbazol-9-yl)butylphosphonic acid |
|---|---|
| PubChem CID | 175561816 |
| Molecular Formula | C16H16I2NO3P |
| Molecular Weight | 555.09 g/mol |
| Exact Mass | 554.90 |
| IUPAC Name | 4-(3,6-diiodocarbazol-9-yl)butylphosphonic acid |
| SMILES | O=P(O)(O)CCCCn1c2ccc(I)cc2c2cc(I)ccc21 |
| InChI | InChI=1S/C16H16I2NO3P/c17-11-3-5-15-13(9-11)14-10-12(18)4-6-16(14)19(15)7-1-2-8-23(20,21)22/h3-6,9-10H,1-2,7-8H2,(H2,20,21,22) |
| InChIKey | PBNCQYVFFSMHNR-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.09 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|