C20H18I3NO2 — CID 19887872
4-(1,3,6-triiodocarbazol-9-yl)butyl 2-methylprop-2-enoate (PubChem CID 19887872) has the molecular formula C20H18I3NO2 and a molecular weight of 685.08 g/mol. Its IUPAC name is 4-(1,3,6-triiodocarbazol-9-yl)butyl 2-methylprop-2-enoate.
| Compound Name | 4-(1,3,6-triiodocarbazol-9-yl)butyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 19887872 |
| Molecular Formula | C20H18I3NO2 |
| Molecular Weight | 685.08 g/mol |
| Exact Mass | 684.85 |
| IUPAC Name | 4-(1,3,6-triiodocarbazol-9-yl)butyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCn1c2ccc(I)cc2c2cc(I)cc(I)c21 |
| InChI | InChI=1S/C20H18I3NO2/c1-12(2)20(25)26-8-4-3-7-24-18-6-5-13(21)9-15(18)16-10-14(22)11-17(23)19(16)24/h5-6,9-11H,1,3-4,7-8H2,2H3 |
| InChIKey | KNPYSSSVUDBTPU-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.08 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|