C14H17NO3 — CID 175562107
[4-(2,6-dimethyl-3,6-dihydro-2H-pyran-4-yl)phenyl] carbamate (PubChem CID 175562107) has the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. Its IUPAC name is [4-(2,6-dimethyl-3,6-dihydro-2H-pyran-4-yl)phenyl] carbamate.
| Compound Name | [4-(2,6-dimethyl-3,6-dihydro-2H-pyran-4-yl)phenyl] carbamate |
|---|---|
| PubChem CID | 175562107 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | [4-(2,6-dimethyl-3,6-dihydro-2H-pyran-4-yl)phenyl] carbamate |
| SMILES | CC1C=C(c2ccc(OC(N)=O)cc2)CC(C)O1 |
| InChI | InChI=1S/C14H17NO3/c1-9-7-12(8-10(2)17-9)11-3-5-13(6-4-11)18-14(15)16/h3-7,9-10H,8H2,1-2H3,(H2,15,16) |
| InChIKey | STXOMJFTECNLQN-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |