C13H22O4 — CID 175563411
(Z)-4-(2-ethylpentoxy)-2,3-dimethyl-4-oxobut-2-enoic acid (PubChem CID 175563411) has the molecular formula C13H22O4 and a molecular weight of 242.31 g/mol. Its IUPAC name is (Z)-4-(2-ethylpentoxy)-2,3-dimethyl-4-oxobut-2-enoic acid.
| Compound Name | (Z)-4-(2-ethylpentoxy)-2,3-dimethyl-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 175563411 |
| Molecular Formula | C13H22O4 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | (Z)-4-(2-ethylpentoxy)-2,3-dimethyl-4-oxobut-2-enoic acid |
| SMILES | CCCC(CC)COC(=O)/C(C)=C(/C)C(=O)O |
| InChI | InChI=1S/C13H22O4/c1-5-7-11(6-2)8-17-13(16)10(4)9(3)12(14)15/h11H,5-8H2,1-4H3,(H,14,15)/b10-9- |
| InChIKey | SDSGOQFBJVIMGL-KTKRTIGZSA-N |
| XLogP | 2.78 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|