C20H20N2O6S — CID 175564410
3-methoxy-4-[[2-(4-propan-2-ylphenyl)-1,3-oxazol-4-yl]-sulfinoamino]benzoic acid (PubChem CID 175564410) has the molecular formula C20H20N2O6S and a molecular weight of 416.46 g/mol. Its IUPAC name is 3-methoxy-4-[[2-(4-propan-2-ylphenyl)-1,3-oxazol-4-yl]-sulfinoamino]benzoic acid.
| Compound Name | 3-methoxy-4-[[2-(4-propan-2-ylphenyl)-1,3-oxazol-4-yl]-sulfinoamino]benzoic acid |
|---|---|
| PubChem CID | 175564410 |
| Molecular Formula | C20H20N2O6S |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | 3-methoxy-4-[[2-(4-propan-2-ylphenyl)-1,3-oxazol-4-yl]-sulfinoamino]benzoic acid |
| SMILES | COc1cc(C(=O)O)ccc1N(c1coc(-c2ccc(C(C)C)cc2)n1)S(=O)O |
| InChI | InChI=1S/C20H20N2O6S/c1-12(2)13-4-6-14(7-5-13)19-21-18(11-28-19)22(29(25)26)16-9-8-15(20(23)24)10-17(16)27-3/h4-12H,1-3H3,(H,23,24)(H,25,26) |
| InChIKey | REYXFRDVUNYFAB-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 113.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|